Product Name: 2,6-Dichloro-4-methylnicotinonitrile
Cas No.: 875-35-4
Molecular Formula: C7H4Cl2N2
Molecular Weigh: 187.03
Appearance: Light yellow powder
Density: 1.42
Purity: 98% Min
Solubility: Slightly soluble in water, ethanol, and acetone, and insoluble in ether.
Boiling point: 317.1 °C at 760 mmHg
Melting point: 108-112 ℃
Flash point: 145.5 °C
Vapour Pressure: 0.0±0.7 mmHg at 25°C
Refractive index: 1.574
SMILES: C(#N)C=1C(C)=CC(Cl)=NC1Cl
InChI Key: InChIKey=LSPMHHJCDSFAAY-UHFFFAOYSA-N
Other Names: 2,6-Dichloro-4-methylnicotinonitrile / Dicnil / NSC 19881

Description:

2,6-Dichloro-4-methylnicotinonitrile, with the CAS number 875-35-4, is a chemical compound that belongs to the class of heterocyclic compounds known as pyridines. It is characterized by its unique chemical structure, consisting of a pyridine ring substituted with both chlorine and methyl groups at specific positions. This compound is of interest in various industrial and research applications due to its distinct properties and potential reactivity.

2,6-Dichloro-4-methylnicotinonitrile finds utility as a building block or intermediate in the synthesis of more complex organic molecules. Its unique structural features make it valuable in the development of pharmaceuticals, agrochemicals, and other fine chemicals. Researchers and chemists often use 2,6-Dichloro-4-methylnicotinonitrile to introduce specific functional groups or structural motifs into their target compounds.

Features:

1. Heterocyclic Structure: 2,6-Dichloro-4-methylnicotinonitrile belongs to the class of heterocyclic compounds known as pyridines. Its pyridine ring contains chlorine and methyl substituents at specific positions, giving it distinct reactivity and properties.
2. Versatile Building Block: This compound serves as a versatile building block in organic synthesis. Its reactive functional groups can be modified or used to create more complex molecules for pharmaceuticals, agrochemicals, and other fine chemicals.
3. Molecular Modification: Chemists can easily modify the structure of 2,6-Dichloro-4-methylnicotinonitrile to introduce desired functional groups. This makes it a valuable tool for customizing molecules with specific properties.
4. Research and Development: Its unique structure and reactivity make it a target for research and development activities, especially in the pharmaceutical and agrochemical industries. Scientists may explore its potential for creating new compounds with improved properties.
5. Solubility and Physical Properties: 2,6-Dichloro-4-methylnicotinonitrile is typically a light yellow crystalline solid that may have limited solubility in water. Its physical properties, such as melting point and boiling point, contribute to its utility in various reactions.
6. Chemical Interactions: The presence of chlorine and methyl groups in the pyridine ring can influence its interactions with other molecules, potentially leading to unique chemical reactions and applications.
7. Research and Laboratory Use: Researchers may use this compound as a reagent in various chemical reactions to synthesize and study new compounds. Its availability and reactivity make it useful for experimental work.

Applications:

1. Pharmaceuticals
It can serve as a versatile intermediate in the synthesis of pharmaceutical compounds, including active pharmaceutical ingredients (APIs). The compound's structural features make it valuable for creating complex molecular structures required in drug development.
2. Agrochemicals
2,6-Dichloro-4-methylnicotinonitrile can be utilized in the synthesis of agrochemicals such as pesticides and herbicides. Its specific chemical reactivity can contribute to the creation of effective agricultural products.
3. Organic Synthesis
The compound's reactivity and specific chemical structure make it a useful building block in various organic synthesis processes. It can be incorporated into diverse chemical reactions to create new molecules for industrial and research purposes.
4. Chemical Research
Researchers may use this compound in the laboratory for exploring new synthetic routes, developing novel compounds, and investigating chemical reactions. Its unique properties can aid in the discovery of new chemical transformations.
5. Specialty Chemicals
The compound's distinct characteristics can make it suitable for the production of specialty chemicals used in specific industrial applications, such as coatings, adhesives, and materials engineering.
6. Intermediates
It can serve as an intermediate in the synthesis of various compounds used across industries, ranging from electronics and materials science to flavors and fragrances.
7. Fine Chemicals
The compound's controlled reactivity and structural features position it as a valuable component in the production of high-value fine chemicals for specific applications.
8. Research and Development
Industries involved in research and development may use this compound to explore its potential applications, create new materials, and optimize processes.

Storage: Store in a cool, dry, and well-ventilated place. It should also be kept in a tightly closed container and locked up to prevent unauthorized access.

Package: 25kg/bag or as per your particular request.