Product Name: 4-Hydrazinobenzene-1-sulfonamide hydrochloride
Cas No.: 17852-52-7
Molecular Formula: C6H9N3O2S.ClH
Molecular Weight: 223.68
Appearance: White powder
Density: 1.644
Purity: 98.5% Min
Solubility: Soluble in water. Soluble in organic solvents such as DMSO and ethanol
Boiling point: 434.7oC at 760 mmHg
Melting point: 217-219 oC
Flash point: 216.7oC
Vapour: 9.25E-08 mmHg at 25°C
Refractive index: 1.67 (Predicted)
SMILES: S(N)(=O)(=O)C1=CC=C(NN)C=C1.Cl
InChI Key: InChIKey=IKEURONJLPUALY-UHFFFAOYSA-N
Other Names: 4-Hydrazinylbenzenesulfonamide hydrochloride / 4-SPH / 4-Hydrazinobenzene-1
Description:
4-Hydrazinobenzene-1-sulfonamide hydrochloride, also known as 4-SPH, 4-Hydrazinylbenzenesulfonamide hydrochloride or 4-Hydrazinobenzene-1, with the CAS number 17852-52-7, is a chemical compound used in various applications. It is a hydrazine derivative and belongs to the sulfonamide class of compounds. This substance is commonly used as an intermediate in the synthesis of pharmaceuticals, agrochemicals, and other organic compounds. As pharmaceutical intermediate, it's mainly used in the production of celecoxib.
Features:
1. Hydrazine Derivative: Being a hydrazine derivative, this compound contains a hydrazine functional group (-NH-NH2) that imparts unique reactivity and versatility in various chemical reactions.
2. Sulfonamide Group: The presence of the sulfonamide group (-SO2NH2) provides enhanced water solubility and contributes to the compound's stability under specific conditions.
3. Intermediate in Synthesis: 4-Hydrazinobenzene-1-sulfonamide hydrochloride serves as a crucial intermediate in the synthesis of pharmaceuticals, agrochemicals, and other organic compounds. Its reactivity allows it to participate in various synthetic pathways to produce diverse end products.
4. Pharmaceutical Applications: The compound's ability to act as an intermediate in pharmaceutical synthesis makes it important for the development of medicinal agents and drugs.
5. Agrochemical Use: It also finds applications in the production of agrochemicals, which are chemicals used in agriculture for pest control and crop protection.
6. Versatility in Organic Synthesis: Due to its unique chemical structure, 4-Hydrazinobenzene-1-sulfonamide hydrochloride can be used in a wide range of organic reactions, making it a valuable building block for creating complex molecules.
Applications:
1. Pharmaceutical Intermediate
The compound serves as an important intermediate in the synthesis of various pharmaceutical agents and drugs, especially in the production of celecoxib (Celebrex). It plays a crucial role in the preparation of pharmaceutical compounds with specific biological activities and therapeutic effects.
2. Agrochemicals
4-Hydrazinobenzene-1-sulfonamide hydrochloride is utilized in the production of agrochemicals, including herbicides, fungicides, pesticide and insecticides. These chemicals are essential for protecting crops and enhancing agricultural productivity.
3. Organic Synthesis
Due to its versatile reactivity, the compound acts as a valuable building block in organic synthesis. It is employed in the creation of complex organic molecules with specific functional groups and structures.
4. Chemical Intermediates
It serves as an intermediate in the synthesis of other specialty chemicals, including dyes, pigments, and catalysts.
5. Water Treatment
In some cases, 4-Hydrazinobenzene-1-sulfonamide hydrochloride is used in water treatment processes to remove certain contaminants and maintain water quality.
6. Biochemical Studies
The compound is employed in biochemical research to study enzyme inhibitors and understand their interactions with specific biological targets.
7. Research and Development
Researchers utilize 4-Hydrazinobenzene-1-sulfonamide hydrochloride as a key component in various scientific studies and chemical research. Its unique properties enable the investigation of new reactions and the development of innovative chemical processes.
Storage: Under inert gas (nitrogen or Argon) at 2-8°C
Package: 50kg/bag or as per your particular request.